C8H9Cl3O2 — CID 135037229
(3aR,4R,7aR)-3,3,4-trichloro-7a-deuterio-4,5,6,7-tetrahydro-3aH-1-benzofuran-2-one (PubChem CID 135037229) has the molecular formula C8H9Cl3O2 and a molecular weight of 244.52 g/mol. Its IUPAC name is (3aR,4R,7aR)-3,3,4-trichloro-7a-deuterio-4,5,6,7-tetrahydro-3aH-1-benzofuran-2-one.
| Compound Name | (3aR,4R,7aR)-3,3,4-trichloro-7a-deuterio-4,5,6,7-tetrahydro-3aH-1-benzofuran-2-one |
|---|---|
| PubChem CID | 135037229 |
| Molecular Formula | C8H9Cl3O2 |
| Molecular Weight | 244.52 g/mol |
| Exact Mass | 242.97 |
| IUPAC Name | (3aR,4R,7aR)-3,3,4-trichloro-7a-deuterio-4,5,6,7-tetrahydro-3aH-1-benzofuran-2-one |
| SMILES | [2H][C@@]12CCC[C@@H](Cl)[C@@H]1C(Cl)(Cl)C(=O)O2 |
| InChI | InChI=1S/C8H9Cl3O2/c9-4-2-1-3-5-6(4)8(10,11)7(12)13-5/h4-6H,1-3H2/t4-,5-,6+/m1/s1/i5D |
| InChIKey | IPQHNZSPPCRMPY-UHYTXZCVSA-N |
| XLogP | 2.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.52 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|