C8H11ClO2 — CID 102192939
(3aR,7S,7aS)-7-chloro-3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-2-one (PubChem CID 102192939) has the molecular formula C8H11ClO2 and a molecular weight of 174.63 g/mol. Its IUPAC name is (3aR,7S,7aS)-7-chloro-3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-2-one.
| Compound Name | (3aR,7S,7aS)-7-chloro-3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-2-one |
|---|---|
| PubChem CID | 102192939 |
| Molecular Formula | C8H11ClO2 |
| Molecular Weight | 174.63 g/mol |
| Exact Mass | 174.04 |
| IUPAC Name | (3aR,7S,7aS)-7-chloro-3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-2-one |
| SMILES | O=C1C[C@H]2CCC[C@H](Cl)[C@H]2O1 |
| InChI | InChI=1S/C8H11ClO2/c9-6-3-1-2-5-4-7(10)11-8(5)6/h5-6,8H,1-4H2/t5-,6+,8+/m1/s1 |
| InChIKey | OZUNBKMJCDYUHT-CHKWXVPMSA-N |
| XLogP | 1.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.63 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|