C12H19ClO2 — CID 102132816
(3aR,6R,7S,7aS)-7-chloro-3a-methyl-6-propan-2-yl-3,4,5,6,7,7a-hexahydro-1-benzofuran-2-one (PubChem CID 102132816) has the molecular formula C12H19ClO2 and a molecular weight of 230.73 g/mol. Its IUPAC name is (3aR,6R,7S,7aS)-7-chloro-3a-methyl-6-propan-2-yl-3,4,5,6,7,7a-hexahydro-1-benzofuran-2-one.
| Compound Name | (3aR,6R,7S,7aS)-7-chloro-3a-methyl-6-propan-2-yl-3,4,5,6,7,7a-hexahydro-1-benzofuran-2-one |
|---|---|
| PubChem CID | 102132816 |
| Molecular Formula | C12H19ClO2 |
| Molecular Weight | 230.73 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | (3aR,6R,7S,7aS)-7-chloro-3a-methyl-6-propan-2-yl-3,4,5,6,7,7a-hexahydro-1-benzofuran-2-one |
| SMILES | CC(C)[C@H]1CC[C@]2(C)CC(=O)O[C@@H]2[C@H]1Cl |
| InChI | InChI=1S/C12H19ClO2/c1-7(2)8-4-5-12(3)6-9(14)15-11(12)10(8)13/h7-8,10-11H,4-6H2,1-3H3/t8-,10+,11-,12-/m1/s1 |
| InChIKey | HNXLOFAQRDXBIE-SASUGWTJSA-N |
| XLogP | 2.98 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.73 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|