C10H15ClO2 — CID 163579029
7-chloro-3a,5-dimethyl-3,4,5,6,7,7a-hexahydro-1-benzofuran-2-one (PubChem CID 163579029) has the molecular formula C10H15ClO2 and a molecular weight of 202.68 g/mol. Its IUPAC name is 7-chloro-3a,5-dimethyl-3,4,5,6,7,7a-hexahydro-1-benzofuran-2-one.
| Compound Name | 7-chloro-3a,5-dimethyl-3,4,5,6,7,7a-hexahydro-1-benzofuran-2-one |
|---|---|
| PubChem CID | 163579029 |
| Molecular Formula | C10H15ClO2 |
| Molecular Weight | 202.68 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | 7-chloro-3a,5-dimethyl-3,4,5,6,7,7a-hexahydro-1-benzofuran-2-one |
| SMILES | CC1CC(Cl)C2OC(=O)CC2(C)C1 |
| InChI | InChI=1S/C10H15ClO2/c1-6-3-7(11)9-10(2,4-6)5-8(12)13-9/h6-7,9H,3-5H2,1-2H3 |
| InChIKey | GFYXITAEFKCLIS-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.68 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|