C9H11Cl3O2 — CID 135037239
(3aR,4R,7aR)-3,3,4-trichloro-4-methyl-5,6,7,7a-tetrahydro-3aH-1-benzofuran-2-one (PubChem CID 135037239) has the molecular formula C9H11Cl3O2 and a molecular weight of 257.54 g/mol. Its IUPAC name is (3aR,4R,7aR)-3,3,4-trichloro-4-methyl-5,6,7,7a-tetrahydro-3aH-1-benzofuran-2-one.
| Compound Name | (3aR,4R,7aR)-3,3,4-trichloro-4-methyl-5,6,7,7a-tetrahydro-3aH-1-benzofuran-2-one |
|---|---|
| PubChem CID | 135037239 |
| Molecular Formula | C9H11Cl3O2 |
| Molecular Weight | 257.54 g/mol |
| Exact Mass | 255.98 |
| IUPAC Name | (3aR,4R,7aR)-3,3,4-trichloro-4-methyl-5,6,7,7a-tetrahydro-3aH-1-benzofuran-2-one |
| SMILES | C[C@@]1(Cl)CCC[C@H]2OC(=O)C(Cl)(Cl)[C@H]21 |
| InChI | InChI=1S/C9H11Cl3O2/c1-8(10)4-2-3-5-6(8)9(11,12)7(13)14-5/h5-6H,2-4H2,1H3/t5-,6-,8-/m1/s1 |
| InChIKey | DHZLWJCRWSIXNM-ATRFCDNQSA-N |
| XLogP | 2.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.54 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|