C20H29NO3 — CID 102192964
methyl (1R,4aS,4bR,8aR,10aS)-8a-(cyanomethyl)-1,4a-dimethyl-7-oxo-2,3,4,4b,5,6,8,9,10,10a-decahydrophenanthrene-1-carboxylate (PubChem CID 102192964) has the molecular formula C20H29NO3 and a molecular weight of 331.46 g/mol. Its IUPAC name is methyl (1R,4aS,4bR,8aR,10aS)-8a-(cyanomethyl)-1,4a-dimethyl-7-oxo-2,3,4,4b,5,6,8,9,10,10a-decahydrophenanthrene-1-carboxylate.
| Compound Name | methyl (1R,4aS,4bR,8aR,10aS)-8a-(cyanomethyl)-1,4a-dimethyl-7-oxo-2,3,4,4b,5,6,8,9,10,10a-decahydrophenanthrene-1-carboxylate |
|---|---|
| PubChem CID | 102192964 |
| Molecular Formula | C20H29NO3 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | methyl (1R,4aS,4bR,8aR,10aS)-8a-(cyanomethyl)-1,4a-dimethyl-7-oxo-2,3,4,4b,5,6,8,9,10,10a-decahydrophenanthrene-1-carboxylate |
| SMILES | COC(=O)[C@]1(C)CCC[C@@]2(C)[C@@H]3CCC(=O)C[C@]3(CC#N)CC[C@@H]21 |
| InChI | InChI=1S/C20H29NO3/c1-18-8-4-9-19(2,17(23)24-3)15(18)7-10-20(11-12-21)13-14(22)5-6-16(18)20/h15-16H,4-11,13H2,1-3H3/t15-,16-,18+,19+,20+/m0/s1 |
| InChIKey | FZSDGDIYFYUJAJ-ORFRNNEJSA-N |
| XLogP | 4.04 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |