C28H29NO3 — CID 102194175
[2-[[4-[(2-tert-butylphenyl)iminomethyl]phenyl]methoxy]-5-ethynyl-3-(hydroxymethyl)phenyl]methanol (PubChem CID 102194175) has the molecular formula C28H29NO3 and a molecular weight of 427.54 g/mol. Its IUPAC name is [2-[[4-[(2-tert-butylphenyl)iminomethyl]phenyl]methoxy]-5-ethynyl-3-(hydroxymethyl)phenyl]methanol.
| Compound Name | [2-[[4-[(2-tert-butylphenyl)iminomethyl]phenyl]methoxy]-5-ethynyl-3-(hydroxymethyl)phenyl]methanol |
|---|---|
| PubChem CID | 102194175 |
| Molecular Formula | C28H29NO3 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | [2-[[4-[(2-tert-butylphenyl)iminomethyl]phenyl]methoxy]-5-ethynyl-3-(hydroxymethyl)phenyl]methanol |
| SMILES | C#Cc1cc(CO)c(OCc2ccc(/C=N/c3ccccc3C(C)(C)C)cc2)c(CO)c1 |
| InChI | InChI=1S/C28H29NO3/c1-5-20-14-23(17-30)27(24(15-20)18-31)32-19-22-12-10-21(11-13-22)16-29-26-9-7-6-8-25(26)28(2,3)4/h1,6-16,30-31H,17-19H2,2-4H3/b29-16+ |
| InChIKey | TUMSEXJPVDPUIV-MUFRIFMGSA-N |
| XLogP | 5.28 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|