C11H11F6NO4S2 — CID 102194852
4-[2-[hydroxy-oxo-(trifluoromethyl)-λ6-sulfanylidene]-2-(trifluoromethylsulfonyl)ethyl]-N-methylaniline (PubChem CID 102194852) has the molecular formula C11H11F6NO4S2 and a molecular weight of 399.33 g/mol. Its IUPAC name is 4-[2-[hydroxy-oxo-(trifluoromethyl)-λ6-sulfanylidene]-2-(trifluoromethylsulfonyl)ethyl]-N-methylaniline.
| Compound Name | 4-[2-[hydroxy-oxo-(trifluoromethyl)-λ6-sulfanylidene]-2-(trifluoromethylsulfonyl)ethyl]-N-methylaniline |
|---|---|
| PubChem CID | 102194852 |
| Molecular Formula | C11H11F6NO4S2 |
| Molecular Weight | 399.33 g/mol |
| Exact Mass | 399.00 |
| IUPAC Name | 4-[2-[hydroxy-oxo-(trifluoromethyl)-λ6-sulfanylidene]-2-(trifluoromethylsulfonyl)ethyl]-N-methylaniline |
| SMILES | CNc1ccc(CC(S(=O)(=O)C(F)(F)F)=S(=O)(O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H11F6NO4S2/c1-18-8-4-2-7(3-5-8)6-9(23(19,20)10(12,13)14)24(21,22)11(15,16)17/h2-5,18H,6H2,1H3,(H,19,20) |
| InChIKey | SHTHHYGUZWQUDN-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.33 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|