C42F28 — CID 102195319
1,2,3,4,7,8,9,10-octafluoro-5,6,11,12-tetrakis(2,3,4,5,6-pentafluorophenyl)tetracene (PubChem CID 102195319) has the molecular formula C42F28 and a molecular weight of 1036.41 g/mol. Its IUPAC name is 1,2,3,4,7,8,9,10-octafluoro-5,6,11,12-tetrakis(2,3,4,5,6-pentafluorophenyl)tetracene.
| Compound Name | 1,2,3,4,7,8,9,10-octafluoro-5,6,11,12-tetrakis(2,3,4,5,6-pentafluorophenyl)tetracene |
|---|---|
| PubChem CID | 102195319 |
| Molecular Formula | C42F28 |
| Molecular Weight | 1036.41 g/mol |
| Exact Mass | 1035.96 |
| IUPAC Name | 1,2,3,4,7,8,9,10-octafluoro-5,6,11,12-tetrakis(2,3,4,5,6-pentafluorophenyl)tetracene |
| SMILES | Fc1c(F)c(F)c(-c2c3c(F)c(F)c(F)c(F)c3c(-c3c(F)c(F)c(F)c(F)c3F)c3c(-c4c(F)c(F)c(F)c(F)c4F)c4c(F)c(F)c(F)c(F)c4c(-c4c(F)c(F)c(F)c(F)c4F)c23)c(F)c1F |
| InChI | InChI=1S/C42F28/c43-15-7-3(11-19(47)31(59)39(67)32(60)20(11)48)1-2(5(9(7)17(45)29(57)27(15)55)13-23(51)35(63)41(69)36(64)24(13)52)6(14-25(53)37(65)42(70)38(66)26(14)54)10-8(16(44)28(56)30(58)18(10)46)4(1)12-21(49)33(61)40(68)34(62)22(12)50 |
| InChIKey | BBMJYUNEOSCAQE-UHFFFAOYSA-N |
| XLogP | 15.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1036.41 |
| LogP ≤ 5 | 15.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|