C24H30O4 — CID 102198240
[(S)-[(1R,2S,3R)-5-(2-adamantylidene)-2,3-dihydroxycyclopentyl]-phenylmethyl] acetate (PubChem CID 102198240) has the molecular formula C24H30O4 and a molecular weight of 382.50 g/mol. Its IUPAC name is [(S)-[(1R,2S,3R)-5-(2-adamantylidene)-2,3-dihydroxycyclopentyl]-phenylmethyl] acetate.
| Compound Name | [(S)-[(1R,2S,3R)-5-(2-adamantylidene)-2,3-dihydroxycyclopentyl]-phenylmethyl] acetate |
|---|---|
| PubChem CID | 102198240 |
| Molecular Formula | C24H30O4 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | [(S)-[(1R,2S,3R)-5-(2-adamantylidene)-2,3-dihydroxycyclopentyl]-phenylmethyl] acetate |
| SMILES | CC(=O)O[C@H](c1ccccc1)[C@@H]1C(=C2C3CC4CC(C3)CC2C4)C[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C24H30O4/c1-13(25)28-24(16-5-3-2-4-6-16)22-19(12-20(26)23(22)27)21-17-8-14-7-15(10-17)11-18(21)9-14/h2-6,14-15,17-18,20,22-24,26-27H,7-12H2,1H3/b21-19-/t14?,15?,17?,18?,20-,22-,23-,24-/m1/s1 |
| InChIKey | CNGINTRUZOYPEM-RSYOUWGGSA-N |
| XLogP | 3.79 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|