C23H25NO3 — CID 53248090
[(S)-[(3R,4S)-1-methyl-4-(2-methylprop-1-enyl)-2-oxopyrrolidin-3-yl]-phenylmethyl] benzoate (PubChem CID 53248090) has the molecular formula C23H25NO3 and a molecular weight of 363.46 g/mol. Its IUPAC name is [(S)-[(3R,4S)-1-methyl-4-(2-methylprop-1-enyl)-2-oxopyrrolidin-3-yl]-phenylmethyl] benzoate.
| Compound Name | [(S)-[(3R,4S)-1-methyl-4-(2-methylprop-1-enyl)-2-oxopyrrolidin-3-yl]-phenylmethyl] benzoate |
|---|---|
| PubChem CID | 53248090 |
| Molecular Formula | C23H25NO3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | [(S)-[(3R,4S)-1-methyl-4-(2-methylprop-1-enyl)-2-oxopyrrolidin-3-yl]-phenylmethyl] benzoate |
| SMILES | CC(C)=C[C@@H]1CN(C)C(=O)[C@H]1[C@H](OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H25NO3/c1-16(2)14-19-15-24(3)22(25)20(19)21(17-10-6-4-7-11-17)27-23(26)18-12-8-5-9-13-18/h4-14,19-21H,15H2,1-3H3/t19-,20-,21-/m1/s1 |
| InChIKey | KFWIFYWTNNAHML-NJDAHSKKSA-N |
| XLogP | 4.26 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|