About [(S)-[(7R,8R)-8-hydroxy-1,4-dioxaspiro[4.5]decan-7-yl]-phenylmethyl] benzoate
[(S)-[(7R,8R)-8-hydroxy-1,4-dioxaspiro[4.5]decan-7-yl]-phenylmethyl] benzoate (PubChem CID 10499256) has the molecular formula C22H24O5
and a molecular weight of 368.43 g/mol. Its IUPAC name is [(S)-[(7R,8R)-8-hydroxy-1,4-dioxaspiro[4.5]decan-7-yl]-phenylmethyl] benzoate.
Molecular Properties
| Compound Name | [(S)-[(7R,8R)-8-hydroxy-1,4-dioxaspiro[4.5]decan-7-yl]-phenylmethyl] benzoate |
| PubChem CID | 10499256 |
| Molecular Formula | C22H24O5 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | [(S)-[(7R,8R)-8-hydroxy-1,4-dioxaspiro[4.5]decan-7-yl]-phenylmethyl] benzoate |
| SMILES | O=C(O[C@H](c1ccccc1)[C@@H]1CC2(CC[C@H]1O)OCCO2)c1ccccc1 |
| InChI | InChI=1S/C22H24O5/c23-19-11-12-22(25-13-14-26-22)15-18(19)20(16-7-3-1-4-8-16)27-21(24)17-9-5-2-6-10-17/h1-10,18-20,23H,11-15H2/t18-,19-,20-/m1/s1 |
| InChIKey | SZLUJXNKFBHPSM-VAMGGRTRSA-N |
| XLogP | 3.49 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(S)-[(7R,8R)-8-hydroxy-1,4-dioxaspiro[4.5]decan-7-yl]-phenylmethyl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(S)-[(7R,8R)-8-hydroxy-1,4-dioxaspiro[4.5]decan-7-yl]-phenylmethyl] benzoate?
The IUPAC name of [(S)-[(7R,8R)-8-hydroxy-1,4-dioxaspiro[4.5]decan-7-yl]-phenylmethyl] benzoate (CID 10499256) is [(S)-[(7R,8R)-8-hydroxy-1,4-dioxaspiro[4.5]decan-7-yl]-phenylmethyl] benzoate.
What is the SMILES notation for [(S)-[(7R,8R)-8-hydroxy-1,4-dioxaspiro[4.5]decan-7-yl]-phenylmethyl] benzoate?
The canonical SMILES for [(S)-[(7R,8R)-8-hydroxy-1,4-dioxaspiro[4.5]decan-7-yl]-phenylmethyl] benzoate is O=C(O[C@H](c1ccccc1)[C@@H]1CC2(CC[C@H]1O)OCCO2)c1ccccc1.
What is the InChIKey of [(S)-[(7R,8R)-8-hydroxy-1,4-dioxaspiro[4.5]decan-7-yl]-phenylmethyl] benzoate?
The InChIKey is SZLUJXNKFBHPSM-VAMGGRTRSA-N. The full InChI is InChI=1S/C22H24O5/c23-19-11-12-22(25-13-14-26-22)15-18(19)20(16-7-3-1-4-8-16)27-21(24)17-9-5-2-6-10-17/h1-10,18-20,23H,11-15H2/t18-,19-,20-/m1/s1.
What are the key properties of [(S)-[(7R,8R)-8-hydroxy-1,4-dioxaspiro[4.5]decan-7-yl]-phenylmethyl] benzoate?
[(S)-[(7R,8R)-8-hydroxy-1,4-dioxaspiro[4.5]decan-7-yl]-phenylmethyl] benzoate has a molecular weight of 368.43 g/mol, XLogP of 3.49, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(S)-[(7R,8R)-8-hydroxy-1,4-dioxaspiro[4.5]decan-7-yl]-phenylmethyl] benzoate is sourced from PubChem (CID 10499256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).