C19H24O3Si — CID 102210503
[(1R,3R)-3-hydroxy-3-phenyl-1-trimethylsilylpropyl] benzoate (PubChem CID 102210503) has the molecular formula C19H24O3Si and a molecular weight of 328.48 g/mol. Its IUPAC name is [(1R,3R)-3-hydroxy-3-phenyl-1-trimethylsilylpropyl] benzoate.
| Compound Name | [(1R,3R)-3-hydroxy-3-phenyl-1-trimethylsilylpropyl] benzoate |
|---|---|
| PubChem CID | 102210503 |
| Molecular Formula | C19H24O3Si |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | [(1R,3R)-3-hydroxy-3-phenyl-1-trimethylsilylpropyl] benzoate |
| SMILES | C[Si](C)(C)[C@H](C[C@@H](O)c1ccccc1)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H24O3Si/c1-23(2,3)18(14-17(20)15-10-6-4-7-11-15)22-19(21)16-12-8-5-9-13-16/h4-13,17-18,20H,14H2,1-3H3/t17-,18-/m1/s1 |
| InChIKey | DSYPJURIXKMGDI-QZTJIDSGSA-N |
| XLogP | 4.21 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|