C23H23N3O3 — CID 72752614
[[1-methyl-4-(3-methylimidazol-4-yl)-2-oxopyrrolidin-3-yl]-phenylmethyl] benzoate (PubChem CID 72752614) has the molecular formula C23H23N3O3 and a molecular weight of 389.46 g/mol. Its IUPAC name is [[1-methyl-4-(3-methylimidazol-4-yl)-2-oxopyrrolidin-3-yl]-phenylmethyl] benzoate.
| Compound Name | [[1-methyl-4-(3-methylimidazol-4-yl)-2-oxopyrrolidin-3-yl]-phenylmethyl] benzoate |
|---|---|
| PubChem CID | 72752614 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | [[1-methyl-4-(3-methylimidazol-4-yl)-2-oxopyrrolidin-3-yl]-phenylmethyl] benzoate |
| SMILES | CN1CC(c2cncn2C)C(C(OC(=O)c2ccccc2)c2ccccc2)C1=O |
| InChI | InChI=1S/C23H23N3O3/c1-25-14-18(19-13-24-15-26(19)2)20(22(25)27)21(16-9-5-3-6-10-16)29-23(28)17-11-7-4-8-12-17/h3-13,15,18,20-21H,14H2,1-2H3 |
| InChIKey | IBZKJMVCDSSXRB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |