C26H23NO3 — CID 102198562
(4R)-4-benzyl-4-[(1R)-3-oxo-1-phenylbutyl]-2-phenyl-1,3-oxazol-5-one (PubChem CID 102198562) has the molecular formula C26H23NO3 and a molecular weight of 397.47 g/mol. Its IUPAC name is (4R)-4-benzyl-4-[(1R)-3-oxo-1-phenylbutyl]-2-phenyl-1,3-oxazol-5-one.
| Compound Name | (4R)-4-benzyl-4-[(1R)-3-oxo-1-phenylbutyl]-2-phenyl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 102198562 |
| Molecular Formula | C26H23NO3 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | (4R)-4-benzyl-4-[(1R)-3-oxo-1-phenylbutyl]-2-phenyl-1,3-oxazol-5-one |
| SMILES | CC(=O)C[C@H](c1ccccc1)[C@@]1(Cc2ccccc2)N=C(c2ccccc2)OC1=O |
| InChI | InChI=1S/C26H23NO3/c1-19(28)17-23(21-13-7-3-8-14-21)26(18-20-11-5-2-6-12-20)25(29)30-24(27-26)22-15-9-4-10-16-22/h2-16,23H,17-18H2,1H3/t23-,26-/m1/s1 |
| InChIKey | VYRZJFLPLWFJFD-ZEQKJWHPSA-N |
| XLogP | 4.73 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |