C38H50N2O2 — CID 102198801
(4R,5R)-2-(1,3-benzodioxol-5-yl)-4,5-bis(3,5-ditert-butylphenyl)-4,5-dihydro-1H-imidazole (PubChem CID 102198801) has the molecular formula C38H50N2O2 and a molecular weight of 566.83 g/mol. Its IUPAC name is (4R,5R)-2-(1,3-benzodioxol-5-yl)-4,5-bis(3,5-ditert-butylphenyl)-4,5-dihydro-1H-imidazole.
| Compound Name | (4R,5R)-2-(1,3-benzodioxol-5-yl)-4,5-bis(3,5-ditert-butylphenyl)-4,5-dihydro-1H-imidazole |
|---|---|
| PubChem CID | 102198801 |
| Molecular Formula | C38H50N2O2 |
| Molecular Weight | 566.83 g/mol |
| Exact Mass | 566.39 |
| IUPAC Name | (4R,5R)-2-(1,3-benzodioxol-5-yl)-4,5-bis(3,5-ditert-butylphenyl)-4,5-dihydro-1H-imidazole |
| SMILES | CC(C)(C)c1cc([C@H]2N=C(c3ccc4c(c3)OCO4)N[C@@H]2c2cc(C(C)(C)C)cc(C(C)(C)C)c2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C38H50N2O2/c1-35(2,3)26-15-24(16-27(20-26)36(4,5)6)32-33(25-17-28(37(7,8)9)21-29(18-25)38(10,11)12)40-34(39-32)23-13-14-30-31(19-23)42-22-41-30/h13-21,32-33H,22H2,1-12H3,(H,39,40)/t32-,33-/m1/s1 |
| InChIKey | GVIVVELYALGNDF-CZNDPXEESA-N |
| XLogP | 9.44 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.83 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |