C13H14ClNO2S2 — CID 102199552
ethyl 3-[(7-chloro-4H-3,1-benzothiazin-2-yl)sulfanyl]propanoate (PubChem CID 102199552) has the molecular formula C13H14ClNO2S2 and a molecular weight of 315.85 g/mol. Its IUPAC name is ethyl 3-[(7-chloro-4H-3,1-benzothiazin-2-yl)sulfanyl]propanoate.
| Compound Name | ethyl 3-[(7-chloro-4H-3,1-benzothiazin-2-yl)sulfanyl]propanoate |
|---|---|
| PubChem CID | 102199552 |
| Molecular Formula | C13H14ClNO2S2 |
| Molecular Weight | 315.85 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | ethyl 3-[(7-chloro-4H-3,1-benzothiazin-2-yl)sulfanyl]propanoate |
| SMILES | CCOC(=O)CCSC1=Nc2cc(Cl)ccc2CS1 |
| InChI | InChI=1S/C13H14ClNO2S2/c1-2-17-12(16)5-6-18-13-15-11-7-10(14)4-3-9(11)8-19-13/h3-4,7H,2,5-6,8H2,1H3 |
| InChIKey | IKPYUJLQBAQNLJ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.85 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |