C26H16N2O5 — CID 102199999
3',6'-dihydroxy-6-(pyridin-2-ylmethylideneamino)spiro[2-benzofuran-3,9'-xanthene]-1-one (PubChem CID 102199999) has the molecular formula C26H16N2O5 and a molecular weight of 436.42 g/mol. Its IUPAC name is 3',6'-dihydroxy-6-(pyridin-2-ylmethylideneamino)spiro[2-benzofuran-3,9'-xanthene]-1-one.
| Compound Name | 3',6'-dihydroxy-6-(pyridin-2-ylmethylideneamino)spiro[2-benzofuran-3,9'-xanthene]-1-one |
|---|---|
| PubChem CID | 102199999 |
| Molecular Formula | C26H16N2O5 |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | 3',6'-dihydroxy-6-(pyridin-2-ylmethylideneamino)spiro[2-benzofuran-3,9'-xanthene]-1-one |
| SMILES | O=C1OC2(c3ccc(O)cc3Oc3cc(O)ccc32)c2ccc(/N=C/c3ccccn3)cc21 |
| InChI | InChI=1S/C26H16N2O5/c29-17-5-8-21-23(12-17)32-24-13-18(30)6-9-22(24)26(21)20-7-4-15(11-19(20)25(31)33-26)28-14-16-3-1-2-10-27-16/h1-14,29-30H/b28-14+ |
| InChIKey | YACINVSZZDLPKN-CCVNUDIWSA-N |
| XLogP | 4.81 |
| TPSA | 101.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|