C33H41NO5Si — CID 102200118
tert-butyl 2-[(6S)-6-[tert-butyl(diphenyl)silyl]oxy-2-oxo-6,7-dihydro-1-benzofuran-7a-yl]pyrrolidine-1-carboxylate (PubChem CID 102200118) has the molecular formula C33H41NO5Si and a molecular weight of 559.78 g/mol. Its IUPAC name is tert-butyl 2-[(6S)-6-[tert-butyl(diphenyl)silyl]oxy-2-oxo-6,7-dihydro-1-benzofuran-7a-yl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[(6S)-6-[tert-butyl(diphenyl)silyl]oxy-2-oxo-6,7-dihydro-1-benzofuran-7a-yl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 102200118 |
| Molecular Formula | C33H41NO5Si |
| Molecular Weight | 559.78 g/mol |
| Exact Mass | 559.28 |
| IUPAC Name | tert-butyl 2-[(6S)-6-[tert-butyl(diphenyl)silyl]oxy-2-oxo-6,7-dihydro-1-benzofuran-7a-yl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1C12C[C@H](O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C=CC1=CC(=O)O2 |
| InChI | InChI=1S/C33H41NO5Si/c1-31(2,3)38-30(36)34-21-13-18-28(34)33-23-25(20-19-24(33)22-29(35)37-33)39-40(32(4,5)6,26-14-9-7-10-15-26)27-16-11-8-12-17-27/h7-12,14-17,19-20,22,25,28H,13,18,21,23H2,1-6H3/t25-,28?,33?/m1/s1 |
| InChIKey | NAUJSXBDMYMCHJ-RPGATNAUSA-N |
| XLogP | 5.51 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.78 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|