About 2-methyl-6-(2-methylpropyl)-2,3,4,5-tetrahydropyridine
2-methyl-6-(2-methylpropyl)-2,3,4,5-tetrahydropyridine (PubChem CID 102202036) has the molecular formula C10H19N
and a molecular weight of 153.27 g/mol. Its IUPAC name is 2-methyl-6-(2-methylpropyl)-2,3,4,5-tetrahydropyridine.
Analyze 2-methyl-6-(2-methylpropyl)-2,3,4,5-tetrahydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-6-(2-methylpropyl)-2,3,4,5-tetrahydropyridine?
The IUPAC name of 2-methyl-6-(2-methylpropyl)-2,3,4,5-tetrahydropyridine (CID 102202036) is 2-methyl-6-(2-methylpropyl)-2,3,4,5-tetrahydropyridine.
What is the SMILES notation for 2-methyl-6-(2-methylpropyl)-2,3,4,5-tetrahydropyridine?
The canonical SMILES for 2-methyl-6-(2-methylpropyl)-2,3,4,5-tetrahydropyridine is CC(C)CC1=NC(C)CCC1.
What is the InChIKey of 2-methyl-6-(2-methylpropyl)-2,3,4,5-tetrahydropyridine?
The InChIKey is YFXHUWLWZFTNLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N/c1-8(2)7-10-6-4-5-9(3)11-10/h8-9H,4-7H2,1-3H3.
What are the key properties of 2-methyl-6-(2-methylpropyl)-2,3,4,5-tetrahydropyridine?
2-methyl-6-(2-methylpropyl)-2,3,4,5-tetrahydropyridine has a molecular weight of 153.27 g/mol, XLogP of 3.05, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6-(2-methylpropyl)-2,3,4,5-tetrahydropyridine is sourced from PubChem (CID 102202036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).