C13H14O5 — CID 102202944
methyl 3-[(3aS,7aS)-3-methylidene-2,5-dioxo-3a,4-dihydro-1-benzofuran-7a-yl]propanoate (PubChem CID 102202944) has the molecular formula C13H14O5 and a molecular weight of 250.25 g/mol. Its IUPAC name is methyl 3-[(3aS,7aS)-3-methylidene-2,5-dioxo-3a,4-dihydro-1-benzofuran-7a-yl]propanoate.
| Compound Name | methyl 3-[(3aS,7aS)-3-methylidene-2,5-dioxo-3a,4-dihydro-1-benzofuran-7a-yl]propanoate |
|---|---|
| PubChem CID | 102202944 |
| Molecular Formula | C13H14O5 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | methyl 3-[(3aS,7aS)-3-methylidene-2,5-dioxo-3a,4-dihydro-1-benzofuran-7a-yl]propanoate |
| SMILES | C=C1C(=O)O[C@@]2(CCC(=O)OC)C=CC(=O)C[C@@H]12 |
| InChI | InChI=1S/C13H14O5/c1-8-10-7-9(14)3-5-13(10,18-12(8)16)6-4-11(15)17-2/h3,5,10H,1,4,6-7H2,2H3/t10-,13+/m0/s1 |
| InChIKey | RAHGYFPTMWMJPN-GXFFZTMASA-N |
| XLogP | 0.94 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|