C24H16N2O5 — CID 102202999
(15S,19S)-1-hydroxy-17-(4-nitrophenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 102202999) has the molecular formula C24H16N2O5 and a molecular weight of 412.40 g/mol. Its IUPAC name is (15S,19S)-1-hydroxy-17-(4-nitrophenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | (15S,19S)-1-hydroxy-17-(4-nitrophenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 102202999 |
| Molecular Formula | C24H16N2O5 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | (15S,19S)-1-hydroxy-17-(4-nitrophenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | O=C1[C@H]2C3c4ccccc4C(O)(c4ccccc43)[C@H]2C(=O)N1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H16N2O5/c27-22-20-19-15-5-1-3-7-17(15)24(29,18-8-4-2-6-16(18)19)21(20)23(28)25(22)13-9-11-14(12-10-13)26(30)31/h1-12,19-21,29H/t19?,20-,21+,24?/m0/s1 |
| InChIKey | YZLXZLILQLRMKK-CAZKKTPXSA-N |
| XLogP | 3.10 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|