C17H20O3 — CID 102203539
[(1R,3S,5R)-3-hydroxy-2-methylidene-5-prop-1-en-2-ylcyclohexyl] benzoate (PubChem CID 102203539) has the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. Its IUPAC name is [(1R,3S,5R)-3-hydroxy-2-methylidene-5-prop-1-en-2-ylcyclohexyl] benzoate.
| Compound Name | [(1R,3S,5R)-3-hydroxy-2-methylidene-5-prop-1-en-2-ylcyclohexyl] benzoate |
|---|---|
| PubChem CID | 102203539 |
| Molecular Formula | C17H20O3 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | [(1R,3S,5R)-3-hydroxy-2-methylidene-5-prop-1-en-2-ylcyclohexyl] benzoate |
| SMILES | C=C(C)[C@@H]1C[C@H](O)C(=C)[C@H](OC(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C17H20O3/c1-11(2)14-9-15(18)12(3)16(10-14)20-17(19)13-7-5-4-6-8-13/h4-8,14-16,18H,1,3,9-10H2,2H3/t14-,15+,16-/m1/s1 |
| InChIKey | PRDKOMOYONODRV-OWCLPIDISA-N |
| XLogP | 3.12 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|