C19H36O2Si — CID 102203795
methyl (3Z)-3-methyl-2-trimethylsilyltetradeca-3,13-dienoate (PubChem CID 102203795) has the molecular formula C19H36O2Si and a molecular weight of 324.58 g/mol. Its IUPAC name is methyl (3Z)-3-methyl-2-trimethylsilyltetradeca-3,13-dienoate.
| Compound Name | methyl (3Z)-3-methyl-2-trimethylsilyltetradeca-3,13-dienoate |
|---|---|
| PubChem CID | 102203795 |
| Molecular Formula | C19H36O2Si |
| Molecular Weight | 324.58 g/mol |
| Exact Mass | 324.25 |
| IUPAC Name | methyl (3Z)-3-methyl-2-trimethylsilyltetradeca-3,13-dienoate |
| SMILES | C=CCCCCCCCC/C=C(/C)C(C(=O)OC)[Si](C)(C)C |
| InChI | InChI=1S/C19H36O2Si/c1-7-8-9-10-11-12-13-14-15-16-17(2)18(19(20)21-3)22(4,5)6/h7,16,18H,1,8-15H2,2-6H3/b17-16- |
| InChIKey | VVJYGJMGHSWCLF-MSUUIHNZSA-N |
| XLogP | 6.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.58 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|