C19H36O2Si — CID 11393179
methyl (E,7E)-7-(triethylsilylmethylidene)undec-4-enoate (PubChem CID 11393179) has the molecular formula C19H36O2Si and a molecular weight of 324.58 g/mol. Its IUPAC name is methyl (E,7E)-7-(triethylsilylmethylidene)undec-4-enoate.
| Compound Name | methyl (E,7E)-7-(triethylsilylmethylidene)undec-4-enoate |
|---|---|
| PubChem CID | 11393179 |
| Molecular Formula | C19H36O2Si |
| Molecular Weight | 324.58 g/mol |
| Exact Mass | 324.25 |
| IUPAC Name | methyl (E,7E)-7-(triethylsilylmethylidene)undec-4-enoate |
| SMILES | CCCC/C(=C\[Si](CC)(CC)CC)C/C=C/CCC(=O)OC |
| InChI | InChI=1S/C19H36O2Si/c1-6-10-14-18(17-22(7-2,8-3)9-4)15-12-11-13-16-19(20)21-5/h11-12,17H,6-10,13-16H2,1-5H3/b12-11+,18-17+ |
| InChIKey | QJPYXHSTGGAQNL-WCPGOBTASA-N |
| XLogP | 6.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.58 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|