C28H46O2Si — CID 91697182
[tert-butyl(dimethyl)silyl] (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate (PubChem CID 91697182) has the molecular formula C28H46O2Si and a molecular weight of 442.76 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate.
| Compound Name | [tert-butyl(dimethyl)silyl] (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate |
|---|---|
| PubChem CID | 91697182 |
| Molecular Formula | C28H46O2Si |
| Molecular Weight | 442.76 g/mol |
| Exact Mass | 442.33 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H46O2Si/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27(29)30-31(5,6)28(2,3)4/h8-9,11-12,14-15,17-18,20-21,23-24H,7,10,13,16,19,22,25-26H2,1-6H3/b9-8-,12-11-,15-14-,18-17-,21-20-,24-23- |
| InChIKey | CIORSZPTYHCMFP-MMRRFZAGSA-N |
| XLogP | 9.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.76 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|