C14H32BNSi2 — CID 102203884
9-[[dimethyl-(trimethylsilylamino)silyl]methyl]-9-borabicyclo[3.3.1]nonane (PubChem CID 102203884) has the molecular formula C14H32BNSi2 and a molecular weight of 281.40 g/mol. Its IUPAC name is 9-[[dimethyl-(trimethylsilylamino)silyl]methyl]-9-borabicyclo[3.3.1]nonane.
| Compound Name | 9-[[dimethyl-(trimethylsilylamino)silyl]methyl]-9-borabicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 102203884 |
| Molecular Formula | C14H32BNSi2 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.22 |
| IUPAC Name | 9-[[dimethyl-(trimethylsilylamino)silyl]methyl]-9-borabicyclo[3.3.1]nonane |
| SMILES | C[Si](C)(C)N[Si](C)(C)CB1C2CCCC1CCC2 |
| InChI | InChI=1S/C14H32BNSi2/c1-17(2,3)16-18(4,5)12-15-13-8-6-9-14(15)11-7-10-13/h13-14,16H,6-12H2,1-5H3 |
| InChIKey | MVKJSUQOMLHMES-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|