C21H25NO — CID 102204543
3,3-bis(2,5-dimethylphenyl)-N,N-dimethylprop-2-enamide (PubChem CID 102204543) has the molecular formula C21H25NO and a molecular weight of 307.44 g/mol. Its IUPAC name is 3,3-bis(2,5-dimethylphenyl)-N,N-dimethylprop-2-enamide.
| Compound Name | 3,3-bis(2,5-dimethylphenyl)-N,N-dimethylprop-2-enamide |
|---|---|
| PubChem CID | 102204543 |
| Molecular Formula | C21H25NO |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | 3,3-bis(2,5-dimethylphenyl)-N,N-dimethylprop-2-enamide |
| SMILES | Cc1ccc(C)c(C(=CC(=O)N(C)C)c2cc(C)ccc2C)c1 |
| InChI | InChI=1S/C21H25NO/c1-14-7-9-16(3)18(11-14)20(13-21(23)22(5)6)19-12-15(2)8-10-17(19)4/h7-13H,1-6H3 |
| InChIKey | QUAGQYJUPRBOIH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|