C37H15F24N — CID 102204600
2,3,4,5-tetrakis[3,5-bis(trifluoromethyl)phenyl]-1-methylpyrrole (PubChem CID 102204600) has the molecular formula C37H15F24N and a molecular weight of 929.49 g/mol. Its IUPAC name is 2,3,4,5-tetrakis[3,5-bis(trifluoromethyl)phenyl]-1-methylpyrrole.
| Compound Name | 2,3,4,5-tetrakis[3,5-bis(trifluoromethyl)phenyl]-1-methylpyrrole |
|---|---|
| PubChem CID | 102204600 |
| Molecular Formula | C37H15F24N |
| Molecular Weight | 929.49 g/mol |
| Exact Mass | 929.08 |
| IUPAC Name | 2,3,4,5-tetrakis[3,5-bis(trifluoromethyl)phenyl]-1-methylpyrrole |
| SMILES | Cn1c(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1-c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C37H15F24N/c1-62-28(16-6-22(34(50,51)52)12-23(7-16)35(53,54)55)26(14-2-18(30(38,39)40)10-19(3-14)31(41,42)43)27(15-4-20(32(44,45)46)11-21(5-15)33(47,48)49)29(62)17-8-24(36(56,57)58)13-25(9-17)37(59,60)61/h2-13H,1H3 |
| InChIKey | GCCKEBALUSMXSF-UHFFFAOYSA-N |
| XLogP | 15.84 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 929.49 |
| LogP ≤ 5 | 15.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |