C9H14NO2- — CID 102207224
propan-2-yl 5-methanidyl-1,2-dihydropyrrole-5-carboxylate (PubChem CID 102207224) has the molecular formula C9H14NO2- and a molecular weight of 168.22 g/mol. Its IUPAC name is propan-2-yl 5-methanidyl-1,2-dihydropyrrole-5-carboxylate.
| Compound Name | propan-2-yl 5-methanidyl-1,2-dihydropyrrole-5-carboxylate |
|---|---|
| PubChem CID | 102207224 |
| Molecular Formula | C9H14NO2- |
| Molecular Weight | 168.22 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | propan-2-yl 5-methanidyl-1,2-dihydropyrrole-5-carboxylate |
| SMILES | [CH2-]C1(C(=O)OC(C)C)C=CCN1 |
| InChI | InChI=1S/C9H14NO2/c1-7(2)12-8(11)9(3)5-4-6-10-9/h4-5,7,10H,3,6H2,1-2H3/q-1 |
| InChIKey | FWDLDESGNUXADN-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.22 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|