C15H23BrO2 — CID 102210291
2-[(1Z,4Z,6Z)-2-bromodeca-1,4,6-trienoxy]oxane (PubChem CID 102210291) has the molecular formula C15H23BrO2 and a molecular weight of 315.25 g/mol. Its IUPAC name is 2-[(1Z,4Z,6Z)-2-bromodeca-1,4,6-trienoxy]oxane.
| Compound Name | 2-[(1Z,4Z,6Z)-2-bromodeca-1,4,6-trienoxy]oxane |
|---|---|
| PubChem CID | 102210291 |
| Molecular Formula | C15H23BrO2 |
| Molecular Weight | 315.25 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 2-[(1Z,4Z,6Z)-2-bromodeca-1,4,6-trienoxy]oxane |
| SMILES | CCC/C=C\C=C/C/C(Br)=C/OC1CCCCO1 |
| InChI | InChI=1S/C15H23BrO2/c1-2-3-4-5-6-7-10-14(16)13-18-15-11-8-9-12-17-15/h4-7,13,15H,2-3,8-12H2,1H3/b5-4-,7-6-,14-13- |
| InChIKey | TYFNFPBVOFLEAC-IWUDQEBGSA-N |
| XLogP | 5.07 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.25 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|