C19H32NNaO5 — CID 102210324
sodium 2-[[(E)-3-carboxypentadec-4-enoyl]-methylamino]acetate (PubChem CID 102210324) has the molecular formula C19H32NNaO5 and a molecular weight of 377.46 g/mol. Its IUPAC name is sodium 2-[[(E)-3-carboxypentadec-4-enoyl]-methylamino]acetate.
| Compound Name | sodium 2-[[(E)-3-carboxypentadec-4-enoyl]-methylamino]acetate |
|---|---|
| PubChem CID | 102210324 |
| Molecular Formula | C19H32NNaO5 |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | sodium 2-[[(E)-3-carboxypentadec-4-enoyl]-methylamino]acetate |
| SMILES | CCCCCCCCCC/C=C/C(CC(=O)N(C)CC(=O)[O-])C(=O)O.[Na+] |
| InChI | InChI=1S/C19H33NO5.Na/c1-3-4-5-6-7-8-9-10-11-12-13-16(19(24)25)14-17(21)20(2)15-18(22)23;/h12-13,16H,3-11,14-15H2,1-2H3,(H,22,23)(H,24,25);/q;+1/p-1/b13-12+; |
| InChIKey | HCZWXSAPYSEDRY-UEIGIMKUSA-M |
| XLogP | -0.62 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|