C24H54N2O12Si6 — CID 102211682
2,4-diisocyanato-2,4,6,8,10,12-hexamethyl-6,8,10,12-tetrakis[(2-methylpropan-2-yl)oxy]-1,3,5,7,9,11-hexaoxa-2,4,6,8,10,12-hexasilacyclododecane (PubChem CID 102211682) has the molecular formula C24H54N2O12Si6 and a molecular weight of 731.21 g/mol. Its IUPAC name is 2,4-diisocyanato-2,4,6,8,10,12-hexamethyl-6,8,10,12-tetrakis[(2-methylpropan-2-yl)oxy]-1,3,5,7,9,11-hexaoxa-2,4,6,8,10,12-hexasilacyclododecane.
| Compound Name | 2,4-diisocyanato-2,4,6,8,10,12-hexamethyl-6,8,10,12-tetrakis[(2-methylpropan-2-yl)oxy]-1,3,5,7,9,11-hexaoxa-2,4,6,8,10,12-hexasilacyclododecane |
|---|---|
| PubChem CID | 102211682 |
| Molecular Formula | C24H54N2O12Si6 |
| Molecular Weight | 731.21 g/mol |
| Exact Mass | 730.23 |
| IUPAC Name | 2,4-diisocyanato-2,4,6,8,10,12-hexamethyl-6,8,10,12-tetrakis[(2-methylpropan-2-yl)oxy]-1,3,5,7,9,11-hexaoxa-2,4,6,8,10,12-hexasilacyclododecane |
| SMILES | CC(C)(C)O[Si]1(C)O[Si](C)(N=C=O)O[Si](C)(N=C=O)O[Si](C)(OC(C)(C)C)O[Si](C)(OC(C)(C)C)O[Si](C)(OC(C)(C)C)O1 |
| InChI | InChI=1S/C24H54N2O12Si6/c1-21(2,3)29-41(15)34-39(13,25-19-27)33-40(14,26-20-28)35-42(16,30-22(4,5)6)37-44(18,32-24(10,11)12)38-43(17,36-41)31-23(7,8)9/h1-18H3 |
| InChIKey | OCGMRJACYNXVFT-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 151.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.21 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|