C15H21FSi — CID 102212098
[(3Z)-3-fluoro-6-phenylhexa-1,3-dien-2-yl]-trimethylsilane (PubChem CID 102212098) has the molecular formula C15H21FSi and a molecular weight of 248.42 g/mol. Its IUPAC name is [(3Z)-3-fluoro-6-phenylhexa-1,3-dien-2-yl]-trimethylsilane.
| Compound Name | [(3Z)-3-fluoro-6-phenylhexa-1,3-dien-2-yl]-trimethylsilane |
|---|---|
| PubChem CID | 102212098 |
| Molecular Formula | C15H21FSi |
| Molecular Weight | 248.42 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | [(3Z)-3-fluoro-6-phenylhexa-1,3-dien-2-yl]-trimethylsilane |
| SMILES | C=C(/C(F)=C/CCc1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C15H21FSi/c1-13(17(2,3)4)15(16)12-8-11-14-9-6-5-7-10-14/h5-7,9-10,12H,1,8,11H2,2-4H3/b15-12- |
| InChIKey | SZCPUYJZUJLJQG-QINSGFPZSA-N |
| XLogP | 4.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.42 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|