C25H22N2O4 — CID 102213252
benzyl N-[[(4R,5S)-8-methyl-3-oxo-12-oxa-2-azatetracyclo[11.4.0.02,5.06,11]heptadeca-1(17),6(11),7,9,13,15-hexaen-4-yl]methyl]carbamate (PubChem CID 102213252) has the molecular formula C25H22N2O4 and a molecular weight of 414.46 g/mol. Its IUPAC name is benzyl N-[[(4R,5S)-8-methyl-3-oxo-12-oxa-2-azatetracyclo[11.4.0.02,5.06,11]heptadeca-1(17),6(11),7,9,13,15-hexaen-4-yl]methyl]carbamate.
| Compound Name | benzyl N-[[(4R,5S)-8-methyl-3-oxo-12-oxa-2-azatetracyclo[11.4.0.02,5.06,11]heptadeca-1(17),6(11),7,9,13,15-hexaen-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 102213252 |
| Molecular Formula | C25H22N2O4 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | benzyl N-[[(4R,5S)-8-methyl-3-oxo-12-oxa-2-azatetracyclo[11.4.0.02,5.06,11]heptadeca-1(17),6(11),7,9,13,15-hexaen-4-yl]methyl]carbamate |
| SMILES | Cc1ccc2c(c1)[C@@H]1[C@@H](CNC(=O)OCc3ccccc3)C(=O)N1c1ccccc1O2 |
| InChI | InChI=1S/C25H22N2O4/c1-16-11-12-21-18(13-16)23-19(14-26-25(29)30-15-17-7-3-2-4-8-17)24(28)27(23)20-9-5-6-10-22(20)31-21/h2-13,19,23H,14-15H2,1H3,(H,26,29)/t19-,23-/m1/s1 |
| InChIKey | FNMVSLPVDREXSU-AUSIDOKSSA-N |
| XLogP | 4.73 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |