C14H24N2O4 — CID 10221473
(2R,4S,5R)-5-[(1R,2S)-1-acetamido-2-hydroxybutyl]-4-[(Z)-prop-1-enyl]pyrrolidine-2-carboxylic acid (PubChem CID 10221473) has the molecular formula C14H24N2O4 and a molecular weight of 284.36 g/mol. Its IUPAC name is (2R,4S,5R)-5-[(1R,2S)-1-acetamido-2-hydroxybutyl]-4-[(Z)-prop-1-enyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R,4S,5R)-5-[(1R,2S)-1-acetamido-2-hydroxybutyl]-4-[(Z)-prop-1-enyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 10221473 |
| Molecular Formula | C14H24N2O4 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | (2R,4S,5R)-5-[(1R,2S)-1-acetamido-2-hydroxybutyl]-4-[(Z)-prop-1-enyl]pyrrolidine-2-carboxylic acid |
| SMILES | C/C=C\[C@@H]1C[C@H](C(=O)O)N[C@H]1[C@@H](NC(C)=O)[C@@H](O)CC |
| InChI | InChI=1S/C14H24N2O4/c1-4-6-9-7-10(14(19)20)16-12(9)13(11(18)5-2)15-8(3)17/h4,6,9-13,16,18H,5,7H2,1-3H3,(H,15,17)(H,19,20)/b6-4-/t9-,10-,11+,12-,13+/m1/s1 |
| InChIKey | AMKLTRGJKNOUNJ-YBVZABDUSA-N |
| XLogP | 0.27 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|