C19H24O2 — CID 10221478
(8S,9S,13S,14S,17R)-4,13-dimethyl-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene-1,17-diol (PubChem CID 10221478) has the molecular formula C19H24O2 and a molecular weight of 284.40 g/mol. Its IUPAC name is (8S,9S,13S,14S,17R)-4,13-dimethyl-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene-1,17-diol.
| Compound Name | (8S,9S,13S,14S,17R)-4,13-dimethyl-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene-1,17-diol |
|---|---|
| PubChem CID | 10221478 |
| Molecular Formula | C19H24O2 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | (8S,9S,13S,14S,17R)-4,13-dimethyl-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene-1,17-diol |
| SMILES | Cc1ccc(O)c2c1C=C[C@@H]1[C@@H]2CC[C@]2(C)[C@H](O)CC[C@@H]12 |
| InChI | InChI=1S/C19H24O2/c1-11-3-7-16(20)18-12(11)4-5-13-14(18)9-10-19(2)15(13)6-8-17(19)21/h3-5,7,13-15,17,20-21H,6,8-10H2,1-2H3/t13-,14+,15+,17-,19+/m1/s1 |
| InChIKey | ZHEMCBVCEHOZQM-YEAFQPLXSA-N |
| XLogP | 4.00 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |