C21H29NO2S — CID 102215498
(1R,3aE,6Z,9aS)-4-methyl-2-(4-methylphenyl)sulfonyl-1-propan-2-yl-1,3,5,8,9,9a-hexahydrocycloocta[c]pyrrole (PubChem CID 102215498) has the molecular formula C21H29NO2S and a molecular weight of 359.54 g/mol. Its IUPAC name is (1R,3aE,6Z,9aS)-4-methyl-2-(4-methylphenyl)sulfonyl-1-propan-2-yl-1,3,5,8,9,9a-hexahydrocycloocta[c]pyrrole.
| Compound Name | (1R,3aE,6Z,9aS)-4-methyl-2-(4-methylphenyl)sulfonyl-1-propan-2-yl-1,3,5,8,9,9a-hexahydrocycloocta[c]pyrrole |
|---|---|
| PubChem CID | 102215498 |
| Molecular Formula | C21H29NO2S |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | (1R,3aE,6Z,9aS)-4-methyl-2-(4-methylphenyl)sulfonyl-1-propan-2-yl-1,3,5,8,9,9a-hexahydrocycloocta[c]pyrrole |
| SMILES | C/C1=C2\CN(S(=O)(=O)c3ccc(C)cc3)[C@H](C(C)C)[C@H]2CC/C=C\C1 |
| InChI | InChI=1S/C21H29NO2S/c1-15(2)21-19-9-7-5-6-8-17(4)20(19)14-22(21)25(23,24)18-12-10-16(3)11-13-18/h5-6,10-13,15,19,21H,7-9,14H2,1-4H3/b6-5-,20-17-/t19-,21+/m0/s1 |
| InChIKey | MFWCJAKLFWIRLL-RGDPPEJLSA-N |
| XLogP | 4.70 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|