C24H23NOS2 — CID 102215893
(4S)-4-benzyl-2-[2,2-bis(phenylsulfanyl)ethyl]-4,5-dihydro-1,3-oxazole (PubChem CID 102215893) has the molecular formula C24H23NOS2 and a molecular weight of 405.59 g/mol. Its IUPAC name is (4S)-4-benzyl-2-[2,2-bis(phenylsulfanyl)ethyl]-4,5-dihydro-1,3-oxazole.
| Compound Name | (4S)-4-benzyl-2-[2,2-bis(phenylsulfanyl)ethyl]-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 102215893 |
| Molecular Formula | C24H23NOS2 |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | (4S)-4-benzyl-2-[2,2-bis(phenylsulfanyl)ethyl]-4,5-dihydro-1,3-oxazole |
| SMILES | c1ccc(C[C@H]2COC(CC(Sc3ccccc3)Sc3ccccc3)=N2)cc1 |
| InChI | InChI=1S/C24H23NOS2/c1-4-10-19(11-5-1)16-20-18-26-23(25-20)17-24(27-21-12-6-2-7-13-21)28-22-14-8-3-9-15-22/h1-15,20,24H,16-18H2/t20-/m0/s1 |
| InChIKey | WMSSCOYONBPMKS-FQEVSTJZSA-N |
| XLogP | 6.33 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|