C30H22F6O3S2 — CID 102216159
2-[3,3,4,4,5,5-hexafluoro-2-(3-methyl-1-benzothiophen-2-yl)cyclopenten-1-yl]-4,6,9-trimethoxy-1-methylbenzo[e][1]benzothiole (PubChem CID 102216159) has the molecular formula C30H22F6O3S2 and a molecular weight of 608.63 g/mol. Its IUPAC name is 2-[3,3,4,4,5,5-hexafluoro-2-(3-methyl-1-benzothiophen-2-yl)cyclopenten-1-yl]-4,6,9-trimethoxy-1-methylbenzo[e][1]benzothiole.
| Compound Name | 2-[3,3,4,4,5,5-hexafluoro-2-(3-methyl-1-benzothiophen-2-yl)cyclopenten-1-yl]-4,6,9-trimethoxy-1-methylbenzo[e][1]benzothiole |
|---|---|
| PubChem CID | 102216159 |
| Molecular Formula | C30H22F6O3S2 |
| Molecular Weight | 608.63 g/mol |
| Exact Mass | 608.09 |
| IUPAC Name | 2-[3,3,4,4,5,5-hexafluoro-2-(3-methyl-1-benzothiophen-2-yl)cyclopenten-1-yl]-4,6,9-trimethoxy-1-methylbenzo[e][1]benzothiole |
| SMILES | COc1ccc(OC)c2c1cc(OC)c1sc(C3=C(c4sc5ccccc5c4C)C(F)(F)C(F)(F)C3(F)F)c(C)c12 |
| InChI | InChI=1S/C30H22F6O3S2/c1-13-15-8-6-7-9-20(15)40-25(13)23-24(29(33,34)30(35,36)28(23,31)32)26-14(2)21-22-16(12-19(39-5)27(21)41-26)17(37-3)10-11-18(22)38-4/h6-12H,1-5H3 |
| InChIKey | QEBWWKAYQXZBPP-UHFFFAOYSA-N |
| XLogP | 9.74 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.63 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|