C26H50O11 — CID 102216844
(2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-[[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(2R,4R,6R,8R)-2,4,6,8-tetramethyldecoxy]oxan-2-yl]methoxy]oxane-3,4,5-triol (PubChem CID 102216844) has the molecular formula C26H50O11 and a molecular weight of 538.68 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-[[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(2R,4R,6R,8R)-2,4,6,8-tetramethyldecoxy]oxan-2-yl]methoxy]oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-[[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(2R,4R,6R,8R)-2,4,6,8-tetramethyldecoxy]oxan-2-yl]methoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 102216844 |
| Molecular Formula | C26H50O11 |
| Molecular Weight | 538.68 g/mol |
| Exact Mass | 538.34 |
| IUPAC Name | (2R,3R,4S,5R,6S)-2-(hydroxymethyl)-6-[[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(2R,4R,6R,8R)-2,4,6,8-tetramethyldecoxy]oxan-2-yl]methoxy]oxane-3,4,5-triol |
| SMILES | CC[C@@H](C)C[C@@H](C)C[C@@H](C)C[C@@H](C)CO[C@@H]1O[C@H](CO[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C26H50O11/c1-6-13(2)7-14(3)8-15(4)9-16(5)11-34-25-24(33)22(31)20(29)18(37-25)12-35-26-23(32)21(30)19(28)17(10-27)36-26/h13-33H,6-12H2,1-5H3/t13-,14-,15-,16-,17-,18-,19+,20-,21+,22+,23-,24-,25-,26+/m1/s1 |
| InChIKey | RBNMONUVYMARLE-RLINVXEKSA-N |
| XLogP | -0.25 |
| TPSA | 178.53 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.68 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |