C34H25NO4 — CID 102217096
ethyl 1'-benzyl-2'-methyl-2,5'-dioxospiro[acenaphthylene-1,4'-indeno[1,2-b]pyridine]-3'-carboxylate (PubChem CID 102217096) has the molecular formula C34H25NO4 and a molecular weight of 511.58 g/mol. Its IUPAC name is ethyl 1'-benzyl-2'-methyl-2,5'-dioxospiro[acenaphthylene-1,4'-indeno[1,2-b]pyridine]-3'-carboxylate.
| Compound Name | ethyl 1'-benzyl-2'-methyl-2,5'-dioxospiro[acenaphthylene-1,4'-indeno[1,2-b]pyridine]-3'-carboxylate |
|---|---|
| PubChem CID | 102217096 |
| Molecular Formula | C34H25NO4 |
| Molecular Weight | 511.58 g/mol |
| Exact Mass | 511.18 |
| IUPAC Name | ethyl 1'-benzyl-2'-methyl-2,5'-dioxospiro[acenaphthylene-1,4'-indeno[1,2-b]pyridine]-3'-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N(Cc2ccccc2)C2=C(C(=O)c3ccccc32)C12C(=O)c1cccc3cccc2c13 |
| InChI | InChI=1S/C34H25NO4/c1-3-39-33(38)28-20(2)35(19-21-11-5-4-6-12-21)30-23-15-7-8-16-24(23)31(36)29(30)34(28)26-18-10-14-22-13-9-17-25(27(22)26)32(34)37/h4-18H,3,19H2,1-2H3 |
| InChIKey | MZPMZGDQIHYCBL-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.58 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dhp_keto_A(9)', 'substructure': 'N/A'} |
|---|