C13H22N2O6Si — CID 102217181
3-hydroxy-1-methyl-2-oxo-N-(3-trimethoxysilylpropyl)pyridine-4-carboxamide (PubChem CID 102217181) has the molecular formula C13H22N2O6Si and a molecular weight of 330.41 g/mol. Its IUPAC name is 3-hydroxy-1-methyl-2-oxo-N-(3-trimethoxysilylpropyl)pyridine-4-carboxamide.
| Compound Name | 3-hydroxy-1-methyl-2-oxo-N-(3-trimethoxysilylpropyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 102217181 |
| Molecular Formula | C13H22N2O6Si |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 3-hydroxy-1-methyl-2-oxo-N-(3-trimethoxysilylpropyl)pyridine-4-carboxamide |
| SMILES | CO[Si](CCCNC(=O)c1ccn(C)c(=O)c1O)(OC)OC |
| InChI | InChI=1S/C13H22N2O6Si/c1-15-8-6-10(11(16)13(15)18)12(17)14-7-5-9-22(19-2,20-3)21-4/h6,8,16H,5,7,9H2,1-4H3,(H,14,17) |
| InChIKey | WBXQSZIIIYYSGG-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|