About 1-[5-amino-4-(3,4-dimethoxyanilino)-1H-pyrazol-3-yl]-3-[2-(1H-imidazol-5-yl)ethyl]urea
1-[5-amino-4-(3,4-dimethoxyanilino)-1H-pyrazol-3-yl]-3-[2-(1H-imidazol-5-yl)ethyl]urea (PubChem CID 10221743) has the molecular formula C17H22N8O3
and a molecular weight of 386.42 g/mol. Its IUPAC name is 1-[5-amino-4-(3,4-dimethoxyanilino)-1H-pyrazol-3-yl]-3-[2-(1H-imidazol-5-yl)ethyl]urea.
Molecular Properties
| Compound Name | 1-[5-amino-4-(3,4-dimethoxyanilino)-1H-pyrazol-3-yl]-3-[2-(1H-imidazol-5-yl)ethyl]urea |
| PubChem CID | 10221743 |
| Molecular Formula | C17H22N8O3 |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | 1-[5-amino-4-(3,4-dimethoxyanilino)-1H-pyrazol-3-yl]-3-[2-(1H-imidazol-5-yl)ethyl]urea |
| SMILES | COc1ccc(Nc2c(NC(=O)NCCc3cnc[nH]3)n[nH]c2N)cc1OC |
| InChI | InChI=1S/C17H22N8O3/c1-27-12-4-3-10(7-13(12)28-2)22-14-15(18)24-25-16(14)23-17(26)20-6-5-11-8-19-9-21-11/h3-4,7-9,22H,5-6H2,1-2H3,(H,19,21)(H5,18,20,23,24,25,26) |
| InChIKey | LUJBVAHEWXXISG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 155.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[5-amino-4-(3,4-dimethoxyanilino)-1H-pyrazol-3-yl]-3-[2-(1H-imidazol-5-yl)ethyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-amino-4-(3,4-dimethoxyanilino)-1H-pyrazol-3-yl]-3-[2-(1H-imidazol-5-yl)ethyl]urea?
The IUPAC name of 1-[5-amino-4-(3,4-dimethoxyanilino)-1H-pyrazol-3-yl]-3-[2-(1H-imidazol-5-yl)ethyl]urea (CID 10221743) is 1-[5-amino-4-(3,4-dimethoxyanilino)-1H-pyrazol-3-yl]-3-[2-(1H-imidazol-5-yl)ethyl]urea.
What is the SMILES notation for 1-[5-amino-4-(3,4-dimethoxyanilino)-1H-pyrazol-3-yl]-3-[2-(1H-imidazol-5-yl)ethyl]urea?
The canonical SMILES for 1-[5-amino-4-(3,4-dimethoxyanilino)-1H-pyrazol-3-yl]-3-[2-(1H-imidazol-5-yl)ethyl]urea is COc1ccc(Nc2c(NC(=O)NCCc3cnc[nH]3)n[nH]c2N)cc1OC.
What is the InChIKey of 1-[5-amino-4-(3,4-dimethoxyanilino)-1H-pyrazol-3-yl]-3-[2-(1H-imidazol-5-yl)ethyl]urea?
The InChIKey is LUJBVAHEWXXISG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22N8O3/c1-27-12-4-3-10(7-13(12)28-2)22-14-15(18)24-25-16(14)23-17(26)20-6-5-11-8-19-9-21-11/h3-4,7-9,22H,5-6H2,1-2H3,(H,19,21)(H5,18,20,23,24,25,26).
What are the key properties of 1-[5-amino-4-(3,4-dimethoxyanilino)-1H-pyrazol-3-yl]-3-[2-(1H-imidazol-5-yl)ethyl]urea?
1-[5-amino-4-(3,4-dimethoxyanilino)-1H-pyrazol-3-yl]-3-[2-(1H-imidazol-5-yl)ethyl]urea has a molecular weight of 386.42 g/mol, XLogP of 1.84, 8 rotatable bonds, 6 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-amino-4-(3,4-dimethoxyanilino)-1H-pyrazol-3-yl]-3-[2-(1H-imidazol-5-yl)ethyl]urea is sourced from PubChem (CID 10221743), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).