C12H14N6S — CID 102219732
4-amino-3-[2-(2-methylbenzimidazol-1-yl)ethyl]-1H-1,2,4-triazole-5-thione (PubChem CID 102219732) has the molecular formula C12H14N6S and a molecular weight of 274.35 g/mol. Its IUPAC name is 4-amino-3-[2-(2-methylbenzimidazol-1-yl)ethyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-amino-3-[2-(2-methylbenzimidazol-1-yl)ethyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 102219732 |
| Molecular Formula | C12H14N6S |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 4-amino-3-[2-(2-methylbenzimidazol-1-yl)ethyl]-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1nc2ccccc2n1CCc1n[nH]c(=S)n1N |
| InChI | InChI=1S/C12H14N6S/c1-8-14-9-4-2-3-5-10(9)17(8)7-6-11-15-16-12(19)18(11)13/h2-5H,6-7,13H2,1H3,(H,16,19) |
| InChIKey | OHTCTOGOORTDAU-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 77.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|