C16H24N2O6S2 — CID 102220005
2-[2-(2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carbonyl)oxyethyldisulfanyl]ethyl 2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate (PubChem CID 102220005) has the molecular formula C16H24N2O6S2 and a molecular weight of 404.51 g/mol. Its IUPAC name is 2-[2-(2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carbonyl)oxyethyldisulfanyl]ethyl 2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate.
| Compound Name | 2-[2-(2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carbonyl)oxyethyldisulfanyl]ethyl 2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate |
|---|---|
| PubChem CID | 102220005 |
| Molecular Formula | C16H24N2O6S2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 2-[2-(2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carbonyl)oxyethyldisulfanyl]ethyl 2-methyl-1-oxido-3,4-dihydropyrrol-1-ium-2-carboxylate |
| SMILES | CC1(C(=O)OCCSSCCOC(=O)C2(C)CCC=[N+]2[O-])CCC=[N+]1[O-] |
| InChI | InChI=1S/C16H24N2O6S2/c1-15(5-3-7-17(15)21)13(19)23-9-11-25-26-12-10-24-14(20)16(2)6-4-8-18(16)22/h7-8H,3-6,9-12H2,1-2H3 |
| InChIKey | SOXFKHMBFWSPEV-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 104.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|