C15H16N2O5 — CID 102221519
tert-butyl 7-nitro-1-oxo-2,3-dihydro-2-benzazepine-5-carboxylate (PubChem CID 102221519) has the molecular formula C15H16N2O5 and a molecular weight of 304.30 g/mol. Its IUPAC name is tert-butyl 7-nitro-1-oxo-2,3-dihydro-2-benzazepine-5-carboxylate.
| Compound Name | tert-butyl 7-nitro-1-oxo-2,3-dihydro-2-benzazepine-5-carboxylate |
|---|---|
| PubChem CID | 102221519 |
| Molecular Formula | C15H16N2O5 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | tert-butyl 7-nitro-1-oxo-2,3-dihydro-2-benzazepine-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1=CCNC(=O)c2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C15H16N2O5/c1-15(2,3)22-14(19)11-6-7-16-13(18)10-5-4-9(17(20)21)8-12(10)11/h4-6,8H,7H2,1-3H3,(H,16,18) |
| InChIKey | HBKHCCAXSRYGCN-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|