C14H13NO3 — CID 102221770
[(3aR,8bS)-4,8b-dihydro-3aH-indeno[1,2-d][1,3]oxazol-2-yl] 2-methylprop-2-enoate (PubChem CID 102221770) has the molecular formula C14H13NO3 and a molecular weight of 243.26 g/mol. Its IUPAC name is [(3aR,8bS)-4,8b-dihydro-3aH-indeno[1,2-d][1,3]oxazol-2-yl] 2-methylprop-2-enoate.
| Compound Name | [(3aR,8bS)-4,8b-dihydro-3aH-indeno[1,2-d][1,3]oxazol-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 102221770 |
| Molecular Formula | C14H13NO3 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | [(3aR,8bS)-4,8b-dihydro-3aH-indeno[1,2-d][1,3]oxazol-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1=N[C@H]2c3ccccc3C[C@H]2O1 |
| InChI | InChI=1S/C14H13NO3/c1-8(2)13(16)18-14-15-12-10-6-4-3-5-9(10)7-11(12)17-14/h3-6,11-12H,1,7H2,2H3/t11-,12+/m1/s1 |
| InChIKey | XFLJMYQONFNNQE-NEPJUHHUSA-N |
| XLogP | 2.16 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|