C18H15ClN2O2 — CID 134844812
N-[2-[(3aS,8bR)-4,8b-dihydro-3aH-indeno[1,2-d][1,3]oxazol-2-yl]phenyl]-2-chloroacetamide (PubChem CID 134844812) has the molecular formula C18H15ClN2O2 and a molecular weight of 326.78 g/mol. Its IUPAC name is N-[2-[(3aS,8bR)-4,8b-dihydro-3aH-indeno[1,2-d][1,3]oxazol-2-yl]phenyl]-2-chloroacetamide.
| Compound Name | N-[2-[(3aS,8bR)-4,8b-dihydro-3aH-indeno[1,2-d][1,3]oxazol-2-yl]phenyl]-2-chloroacetamide |
|---|---|
| PubChem CID | 134844812 |
| Molecular Formula | C18H15ClN2O2 |
| Molecular Weight | 326.78 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | N-[2-[(3aS,8bR)-4,8b-dihydro-3aH-indeno[1,2-d][1,3]oxazol-2-yl]phenyl]-2-chloroacetamide |
| SMILES | O=C(CCl)Nc1ccccc1C1=N[C@@H]2c3ccccc3C[C@@H]2O1 |
| InChI | InChI=1S/C18H15ClN2O2/c19-10-16(22)20-14-8-4-3-7-13(14)18-21-17-12-6-2-1-5-11(12)9-15(17)23-18/h1-8,15,17H,9-10H2,(H,20,22)/t15-,17+/m0/s1 |
| InChIKey | DTZSHGANOWIJAV-DOTOQJQBSA-N |
| XLogP | 3.31 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.78 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|