C23H44O2Si2 — CID 102224773
tert-butyl-dimethyl-[(2S)-1-[(1R,2R,3R,6S)-3-methyl-6-prop-1-en-2-yl-2-trimethylsilyloxycyclohexyl]but-3-yn-2-yl]oxysilane (PubChem CID 102224773) has the molecular formula C23H44O2Si2 and a molecular weight of 408.78 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2S)-1-[(1R,2R,3R,6S)-3-methyl-6-prop-1-en-2-yl-2-trimethylsilyloxycyclohexyl]but-3-yn-2-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(2S)-1-[(1R,2R,3R,6S)-3-methyl-6-prop-1-en-2-yl-2-trimethylsilyloxycyclohexyl]but-3-yn-2-yl]oxysilane |
|---|---|
| PubChem CID | 102224773 |
| Molecular Formula | C23H44O2Si2 |
| Molecular Weight | 408.78 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | tert-butyl-dimethyl-[(2S)-1-[(1R,2R,3R,6S)-3-methyl-6-prop-1-en-2-yl-2-trimethylsilyloxycyclohexyl]but-3-yn-2-yl]oxysilane |
| SMILES | C#C[C@H](C[C@H]1[C@H](O[Si](C)(C)C)[C@H](C)CC[C@@H]1C(=C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H44O2Si2/c1-13-19(24-27(11,12)23(5,6)7)16-21-20(17(2)3)15-14-18(4)22(21)25-26(8,9)10/h1,18-22H,2,14-16H2,3-12H3/t18-,19-,20-,21-,22-/m1/s1 |
| InChIKey | XWEDKIVOMCBWNP-ZGJYDULXSA-N |
| XLogP | 6.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.78 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|